Products 1214333-88-6

CAS 1214333-88-6 appears in our catalog under these names: 3,6-Dibromopicolinonitrile 95%, 3,6-Dibromopicolinonitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3,6-dibromopyridine-2-carbonitrile (CAS 1214333-88-6) is a chemical compound with the molecular formula C6H2Br2N2 and a molecular weight of 261.90 g/mol. IUPAC name: 3,6-dibromopyridine-2-carbonitrile. InChIKey: YEZKRLCYDFESFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Br2N2
Molecular weight261.90 g/mol
IUPAC name3,6-dibromopyridine-2-carbonitrile
InChIKeyYEZKRLCYDFESFZ-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1Br)C#N)Br

Computed by PubChem (NCBI)