Products 1214340-41-6

CAS 1214340-41-6 appears in our catalog under these names: 2,5-Dibromonicotinonitrile, 95%, 2,5–Dibromonicotinonitrile, 2,5-Dibromonicotinonitrile, 97%, 97%, 2,5-Dibromonicotinonitrile, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25mg.

Structural formula: {0} (CAS {1})

2,5-dibromopyridine-3-carbonitrile (CAS 1214340-41-6) is a chemical compound with the molecular formula C6H2Br2N2 and a molecular weight of 261.90 g/mol. IUPAC name: 2,5-dibromopyridine-3-carbonitrile. InChIKey: LWRPXLRIRYXURL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2Br2N2
Molecular weight261.90 g/mol
IUPAC name2,5-dibromopyridine-3-carbonitrile
InChIKeyLWRPXLRIRYXURL-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1C#N)Br)Br

Computed by PubChem (NCBI)