CAS 1214337-61-7 is the registry number for (3,3'-Bipyridine)-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-pyridin-3-ylpyridine-2-carbonitrile (CAS 1214337-61-7) is a chemical compound with the molecular formula C11H7N3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-pyridin-3-ylpyridine-2-carbonitrile. InChIKey: MSCCHWQGKUMKGJ-UHFFFAOYSA-N.
| Molecular formula | C11H7N3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-pyridin-3-ylpyridine-2-carbonitrile |
| InChIKey | MSCCHWQGKUMKGJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CN=C(C=C2)C#N |
Computed by PubChem (NCBI)