CAS 230-48-8 is the registry number for Pyrido[3,2-f]quinoxaline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Pyrido[3,2-f]quinoxaline (CAS 230-48-8) is a chemical compound with the molecular formula C11H7N3 and a molecular weight of 181.19 g/mol. IUPAC name: pyrido[3,2-f]quinoxaline. InChIKey: ZIAQCYZPKDIKRM-UHFFFAOYSA-N.
| Molecular formula | C11H7N3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | pyrido[3,2-f]quinoxaline |
| InChIKey | ZIAQCYZPKDIKRM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=NC=CN=C23)N=C1 |
Computed by PubChem (NCBI)