CAS 1214340-55-2 appears in our catalog under these names: 1,3-Dibromo-2-(trifluoromethyl)benzene 97%, 1,3-Dibromo-2-(trifluoromethyl)benzene, 97%, 97%, 2,6-Dibromobenzotrifluoride, 95%. Offered by: Ambeed, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-2-(trifluoromethyl)benzene (CAS 1214340-55-2) is a chemical compound with the molecular formula C7H3Br2F3 and a molecular weight of 303.90 g/mol. IUPAC name: 1,3-dibromo-2-(trifluoromethyl)benzene. InChIKey: XNTHEEFOQJXUNF-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3 |
|---|---|
| Molecular weight | 303.90 g/mol |
| IUPAC name | 1,3-dibromo-2-(trifluoromethyl)benzene |
| InChIKey | XNTHEEFOQJXUNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)