CAS 1260903-09-0 is the registry number for 3-Bromo-2,4,5-trifluorobenzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-bromo-1-(bromomethyl)-2,4,5-trifluorobenzene (CAS 1260903-09-0) is a chemical compound with the molecular formula C7H3Br2F3 and a molecular weight of 303.90 g/mol. IUPAC name: 3-bromo-1-(bromomethyl)-2,4,5-trifluorobenzene. InChIKey: ZPRFYOQQRJZFTO-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3 |
|---|---|
| Molecular weight | 303.90 g/mol |
| IUPAC name | 3-bromo-1-(bromomethyl)-2,4,5-trifluorobenzene |
| InChIKey | ZPRFYOQQRJZFTO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)CBr |
Computed by PubChem (NCBI)