CAS 1214340-98-3 is the registry number for 4-(Chloromethyl)-2,4'-difluoro-1,1'-biphenyl. Offered by: TRC. Available pack sizes: 25mg.
4-(chloromethyl)-2-fluoro-1-(4-fluorophenyl)benzene (CAS 1214340-98-3) is a chemical compound with the molecular formula C13H9ClF2 and a molecular weight of 238.66 g/mol. IUPAC name: 4-(chloromethyl)-2-fluoro-1-(4-fluorophenyl)benzene. InChIKey: SIIIJRFAWIPSRG-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2 |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 4-(chloromethyl)-2-fluoro-1-(4-fluorophenyl)benzene |
| InChIKey | SIIIJRFAWIPSRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)CCl)F)F |
Computed by PubChem (NCBI)