CAS 2755722-74-6 is the registry number for 6-Chloro-2,4'-difluoro-3-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-3-fluoro-2-(4-fluorophenyl)-4-methylbenzene (CAS 2755722-74-6) is a chemical compound with the molecular formula C13H9ClF2 and a molecular weight of 238.66 g/mol. IUPAC name: 1-chloro-3-fluoro-2-(4-fluorophenyl)-4-methylbenzene. InChIKey: XPOHKJCFCCYPCH-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2 |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 1-chloro-3-fluoro-2-(4-fluorophenyl)-4-methylbenzene |
| InChIKey | XPOHKJCFCCYPCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)