CAS 1214349-61-7 is the registry number for 3'-Fluoro-2-(trifluoromethyl)-[1,1'-biphenyl]-4-carbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(3-fluorophenyl)-3-(trifluoromethyl)benzaldehyde (CAS 1214349-61-7) is a chemical compound with the molecular formula C14H8F4O and a molecular weight of 268.21 g/mol. IUPAC name: 4-(3-fluorophenyl)-3-(trifluoromethyl)benzaldehyde. InChIKey: DZGBYTDLVVBJHX-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | 4-(3-fluorophenyl)-3-(trifluoromethyl)benzaldehyde |
| InChIKey | DZGBYTDLVVBJHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=C(C=C(C=C2)C=O)C(F)(F)F |
Computed by PubChem (NCBI)