CAS 239087-04-8 is the registry number for 4-Fluoro-3-(trifluoromethyl)benzophenone, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
[4-fluoro-3-(trifluoromethyl)phenyl]-phenylmethanone (CAS 239087-04-8) is a chemical compound with the molecular formula C14H8F4O and a molecular weight of 268.21 g/mol. IUPAC name: [4-fluoro-3-(trifluoromethyl)phenyl]-phenylmethanone. InChIKey: BWBZTYREKMHBFH-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O |
|---|---|
| Molecular weight | 268.21 g/mol |
| IUPAC name | [4-fluoro-3-(trifluoromethyl)phenyl]-phenylmethanone |
| InChIKey | BWBZTYREKMHBFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)