CAS 1214379-56-2 appears in our catalog under these names: 4-(Difluoromethoxy)-3-fluorobenzaldehyde, 98%, 4-(Difluoromethoxy)-3-fluorobenzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 5g.
4-(difluoromethoxy)-3-fluorobenzaldehyde (CAS 1214379-56-2) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 4-(difluoromethoxy)-3-fluorobenzaldehyde. InChIKey: BBQMURAQGGKHNN-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 4-(difluoromethoxy)-3-fluorobenzaldehyde |
| InChIKey | BBQMURAQGGKHNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)F)OC(F)F |
Computed by PubChem (NCBI)