CAS 1214387-79-7 appears in our catalog under these names: Ethyl 3-bromo-5-chloroisonicotinate, 95+%, Ethyl 3-bromo-5-chloroisonicotinate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Ethyl 3-bromo-5-chloropyridine-4-carboxylate (CAS 1214387-79-7) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: ethyl 3-bromo-5-chloropyridine-4-carboxylate. InChIKey: OBPQHNOYXBZPLJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | ethyl 3-bromo-5-chloropyridine-4-carboxylate |
| InChIKey | OBPQHNOYXBZPLJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Cl)Br |
Computed by PubChem (NCBI)