Products 1214387-96-8
CAS 1214387-96-8 is the registry number for 2,6-Difluoro-4-(4-pyridinyl)benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2,6-difluoro-4-pyridin-4-ylaniline (CAS 1214387-96-8) is a chemical compound with the molecular formula C11H8F2N2 and a molecular weight of 206.19 g/mol. IUPAC name: 2,6-difluoro-4-pyridin-4-ylaniline. InChIKey: MZWCEUYKSMFMFU-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2,6-difluoro-4-pyridin-4-ylaniline |
| InChIKey | MZWCEUYKSMFMFU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC(=C(C(=C2)F)N)F |
Computed by PubChem (NCBI)