CAS 1551869-26-1 appears in our catalog under these names: 2-(2,6-Difluorophenyl)pyridin-3-amine, 95%, 2-(2,6-Difluorophenyl)pyridin-3-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,6-difluorophenyl)pyridin-3-amine (CAS 1551869-26-1) is a chemical compound with the molecular formula C11H8F2N2 and a molecular weight of 206.19 g/mol. IUPAC name: 2-(2,6-difluorophenyl)pyridin-3-amine. InChIKey: MKXMMSMICMBQGT-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)pyridin-3-amine |
| InChIKey | MKXMMSMICMBQGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=C(C=CC=N2)N)F |
Computed by PubChem (NCBI)