CAS 1214388-04-1 appears in our catalog under these names: Ethyl 3-chloro-2-hydroxyisonicotinate, 97%, Ethyl 3-chloro-2-hydroxypyridine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 3-chloro-2-oxo-1H-pyridine-4-carboxylate (CAS 1214388-04-1) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: ethyl 3-chloro-2-oxo-1H-pyridine-4-carboxylate. InChIKey: JSWVYTKRQAHONO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | ethyl 3-chloro-2-oxo-1H-pyridine-4-carboxylate |
| InChIKey | JSWVYTKRQAHONO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)NC=C1)Cl |
Computed by PubChem (NCBI)