CAS 1214838-59-1 is the registry number for 2-((4-Bromophenyl)sulfonamido)-N,N-dimethylpropanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-bromophenyl)sulfonylamino]-N,N-dimethylpropanamide (CAS 1214838-59-1) is a chemical compound with the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. IUPAC name: 2-[(4-bromophenyl)sulfonylamino]-N,N-dimethylpropanamide. InChIKey: SFXSHGRHRPBGMV-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O3S |
|---|---|
| Molecular weight | 335.22 g/mol |
| IUPAC name | 2-[(4-bromophenyl)sulfonylamino]-N,N-dimethylpropanamide |
| InChIKey | SFXSHGRHRPBGMV-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N(C)C)NS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)