CAS 2270911-99-2 is the registry number for 3-Bromo-5-ethanesulfonylamino-n,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-5-(ethylsulfonylamino)-N,N-dimethylbenzamide (CAS 2270911-99-2) is a chemical compound with the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. IUPAC name: 3-bromo-5-(ethylsulfonylamino)-N,N-dimethylbenzamide. InChIKey: JMQNUGALFXHSEA-UHFFFAOYSA-N.
| Molecular formula | C11H15BrN2O3S |
|---|---|
| Molecular weight | 335.22 g/mol |
| IUPAC name | 3-bromo-5-(ethylsulfonylamino)-N,N-dimethylbenzamide |
| InChIKey | JMQNUGALFXHSEA-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)NC1=CC(=CC(=C1)C(=O)N(C)C)Br |
Computed by PubChem (NCBI)