CAS 121490-66-2 appears in our catalog under these names: 8-Chloroquinoline-4-carboxylic acid, 95%, 8–Chloroquinoline–4–carboxylic acid, 8-Chloroquinoline-4-carboxylic acid, 98%, 98%, 8-CHLOROQUINOLINE-4-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
8-chloroquinoline-4-carboxylic acid (CAS 121490-66-2) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 8-chloroquinoline-4-carboxylic acid. InChIKey: FDOWCPBIOYKIND-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 8-chloroquinoline-4-carboxylic acid |
| InChIKey | FDOWCPBIOYKIND-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)