Products 121490-68-4
CAS 121490-68-4 appears in our catalog under these names: 8-Chloroquinoline-5-carboxylic acid, 95%, 8-Chloroquinoline-5-carboxylic acid, 95+%, 8-Chloroquinoline-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 50mg, 0,5g.
8-chloroquinoline-5-carboxylic acid (CAS 121490-68-4) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 8-chloroquinoline-5-carboxylic acid. InChIKey: YCJCLDOHESCJRP-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 8-chloroquinoline-5-carboxylic acid |
| InChIKey | YCJCLDOHESCJRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)