CAS 1214900-47-6 is the registry number for 6-Iodo-3,3-dimethyl-1,3-dihydroindol-2-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-3,3-dimethyl-1H-indol-2-one (CAS 1214900-47-6) is a chemical compound with the molecular formula C10H10INO and a molecular weight of 287.10 g/mol. IUPAC name: 6-iodo-3,3-dimethyl-1H-indol-2-one. InChIKey: GWOJFJPYMXRQEY-UHFFFAOYSA-N.
| Molecular formula | C10H10INO |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 6-iodo-3,3-dimethyl-1H-indol-2-one |
| InChIKey | GWOJFJPYMXRQEY-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)I)NC1=O)C |
Computed by PubChem (NCBI)