CAS 200573-05-3 is the registry number for 5-(Iodomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(iodomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole (CAS 200573-05-3) is a chemical compound with the molecular formula C10H10INO and a molecular weight of 287.10 g/mol. IUPAC name: 5-(iodomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: YMHOTMGSGXOMNO-UHFFFAOYSA-N.
| Molecular formula | C10H10INO |
|---|---|
| Molecular weight | 287.10 g/mol |
| IUPAC name | 5-(iodomethyl)-2-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | YMHOTMGSGXOMNO-UHFFFAOYSA-N |
| SMILES | C1C(OC(=N1)C2=CC=CC=C2)CI |
Computed by PubChem (NCBI)