CAS 1215092-16-2 appears in our catalog under these names: (S)-2-Amino-3-(4-iodophenyl)-2-methylpropanoic acid, 95%, H-alpha-Me-L-Phe(4-I)-OH. Offered by: AmBeed, Creative Peptides. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-(4-iodophenyl)-2-methylpropanoic acid (CAS 1215092-16-2) is a chemical compound with the molecular formula C10H12INO2 and a molecular weight of 305.11 g/mol. IUPAC name: (2S)-2-amino-3-(4-iodophenyl)-2-methylpropanoic acid. InChIKey: YNCJAZPOXKKAMD-JTQLQIEISA-N.
| Molecular formula | C10H12INO2 |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-iodophenyl)-2-methylpropanoic acid |
| InChIKey | YNCJAZPOXKKAMD-JTQLQIEISA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)I)(C(=O)O)N |
Computed by PubChem (NCBI)