Products 1691175-25-3
CAS 1691175-25-3 is the registry number for 3-Hydroxy-4-iodo-n-(propan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-hydroxy-4-iodo-N-propan-2-ylbenzamide (CAS 1691175-25-3) is a chemical compound with the molecular formula C10H12INO2 and a molecular weight of 305.11 g/mol. IUPAC name: 3-hydroxy-4-iodo-N-propan-2-ylbenzamide. InChIKey: PXNGZPOGJZAJFY-UHFFFAOYSA-N.
| Molecular formula | C10H12INO2 |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | 3-hydroxy-4-iodo-N-propan-2-ylbenzamide |
| InChIKey | PXNGZPOGJZAJFY-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=C(C=C1)I)O |
Computed by PubChem (NCBI)