Products 1215205-41-6
CAS 1215205-41-6 is the registry number for 2'-Methoxy-4'-methylbiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(2-methoxy-4-methylphenyl)benzoic acid (CAS 1215205-41-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 3-(2-methoxy-4-methylphenyl)benzoic acid. InChIKey: FKGXYHAOXXNKQI-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 3-(2-methoxy-4-methylphenyl)benzoic acid |
| InChIKey | FKGXYHAOXXNKQI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)OC |
Computed by PubChem (NCBI)
Synonyms:
3-(2-methoxy-4-methylphenyl)benzoic acid, 2-Methoxy-4-methylbiphenyl-3-carboxylic acid, 2'-Methoxy-4'-methyl biphenyl-3-carboxylic acid, 3-(2-methoxy-4-methyl-phenyl)benzoic acid, 2'-Methoxy-4'-methyl[1,1'-biphenyl]-3-carboxylic acid, [1,1'-Biphenyl]-3-carboxylic acid, 2'-methoxy-4'-methyl-