Products 1215205-65-4
CAS 1215205-65-4 is the registry number for 4-Bromo-1-(2,6-dichlorophenyl)-1H-pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-1-(2,6-dichlorophenyl)pyrazole (CAS 1215205-65-4) is a chemical compound with the molecular formula C9H5BrCl2N2 and a molecular weight of 291.96 g/mol. IUPAC name: 4-bromo-1-(2,6-dichlorophenyl)pyrazole. InChIKey: GPBJDPMTMSMWPY-UHFFFAOYSA-N.
| Molecular formula | C9H5BrCl2N2 |
|---|---|
| Molecular weight | 291.96 g/mol |
| IUPAC name | 4-bromo-1-(2,6-dichlorophenyl)pyrazole |
| InChIKey | GPBJDPMTMSMWPY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C=C(C=N2)Br)Cl |
Computed by PubChem (NCBI)