CAS 2883761-31-5 is the registry number for 6-Bromo-4,8-dichloro-2-methylquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4,8-dichloro-2-methylquinazoline (CAS 2883761-31-5) is a chemical compound with the molecular formula C9H5BrCl2N2 and a molecular weight of 291.96 g/mol. IUPAC name: 6-bromo-4,8-dichloro-2-methylquinazoline. InChIKey: CKAGPJRTRSXNJA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrCl2N2 |
|---|---|
| Molecular weight | 291.96 g/mol |
| IUPAC name | 6-bromo-4,8-dichloro-2-methylquinazoline |
| InChIKey | CKAGPJRTRSXNJA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2Cl)Br)C(=N1)Cl |
Computed by PubChem (NCBI)