CAS 1215206-33-9 is the registry number for 2'-Fluoro-4'-methylbiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-(2-fluoro-4-methylphenyl)benzoic acid (CAS 1215206-33-9) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 3-(2-fluoro-4-methylphenyl)benzoic acid. InChIKey: YJUVMAOSWHFUOK-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 3-(2-fluoro-4-methylphenyl)benzoic acid |
| InChIKey | YJUVMAOSWHFUOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC(=CC=C2)C(=O)O)F |
Computed by PubChem (NCBI)