Products 1215206-34-0

CAS 1215206-34-0 is the registry number for 6-(Trifluoromethoxy)quinoline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

6-(trifluoromethoxy)quinoline;hydrochloride (CAS 1215206-34-0) is a chemical compound with the molecular formula C10H7ClF3NO and a molecular weight of 249.61 g/mol. IUPAC name: 6-(trifluoromethoxy)quinoline;hydrochloride. InChIKey: YXYBRJPHNSMIAC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7ClF3NO
Molecular weight249.61 g/mol
IUPAC name6-(trifluoromethoxy)quinoline;hydrochloride
InChIKeyYXYBRJPHNSMIAC-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)OC(F)(F)F)N=C1.Cl

Computed by PubChem (NCBI)