Products 168834-38-6
CAS 168834-38-6 is the registry number for 2-Amino-5-chloro-alpha-ethynyl-alpha-(trifluoromethyl)benzenemethanol. Offered by: TRC. Available pack sizes: 100mg.
2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol (CAS 168834-38-6) is a chemical compound with the molecular formula C10H7ClF3NO and a molecular weight of 249.61 g/mol. IUPAC name: 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol. InChIKey: SENLZSXKQUSKOS-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF3NO |
|---|---|
| Molecular weight | 249.61 g/mol |
| IUPAC name | 2-(2-amino-5-chlorophenyl)-1,1,1-trifluorobut-3-yn-2-ol |
| InChIKey | SENLZSXKQUSKOS-UHFFFAOYSA-N |
| SMILES | C#CC(C1=C(C=CC(=C1)Cl)N)(C(F)(F)F)O |
Computed by PubChem (NCBI)