Products 1215319-22-4
CAS 1215319-22-4 is the registry number for 2-(5-Bromoimidazo[1,2-a]pyridin-2-yl)acetic acid, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(5-bromoimidazo[1,2-a]pyridin-2-yl)acetic acid (CAS 1215319-22-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 2-(5-bromoimidazo[1,2-a]pyridin-2-yl)acetic acid. InChIKey: VRRYVLADHDXCAA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 2-(5-bromoimidazo[1,2-a]pyridin-2-yl)acetic acid |
| InChIKey | VRRYVLADHDXCAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C(=C1)Br)CC(=O)O |
Computed by PubChem (NCBI)