CAS 1215327-00-6 appears in our catalog under these names: Alverine-d5 Citrate, Alverine-d5, Alverine-d5 Citrate, >95% (HPLC), Alverine–d5 Citrate, Alverine-d5 (citrate), 98.52%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 1mg, 5mg, 5 mg, 1 mg.
2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1,1,2,2,2-pentadeuterioethyl)-3-phenyl-N-(3-phenylpropyl)propan-1-amine (CAS 1215327-00-6) is a chemical compound with the molecular formula C26H35NO7 and a molecular weight of 478.6 g/mol. IUPAC name: 2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1,1,2,2,2-pentadeuterioethyl)-3-phenyl-N-(3-phenylpropyl)propan-1-amine. InChIKey: RYHCACJBKCOBTJ-LUIAAVAXSA-N.
| Molecular formula | C26H35NO7 |
|---|---|
| Molecular weight | 478.6 g/mol |
| IUPAC name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-(1,1,2,2,2-pentadeuterioethyl)-3-phenyl-N-(3-phenylpropyl)propan-1-amine |
| InChIKey | RYHCACJBKCOBTJ-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(CCCC1=CC=CC=C1)CCCC2=CC=CC=C2.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)