CAS 3200-06-4 appears in our catalog under these names: Nafronyl oxalate, 95%, Nafronyl Oxalate, Nafronyl hydrogenoxalate, Naftidrofuryl Hydrogen Oxalate, Naftidrofuryl oxalate. Offered by: Combi-blocks, Chemat Brand, Dr. Ehrenstorfer, Mikromol, LoGiCal. Available pack sizes: 1g, 5g, 10g, on request, 100mg, 500mg, 10mg, 10mM (in 1ml dmso).
2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate;oxalic acid (CAS 3200-06-4) is a chemical compound with the molecular formula C26H35NO7 and a molecular weight of 473.6 g/mol. IUPAC name: 2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate;oxalic acid. InChIKey: SSAJNPNVUYMUCI-UHFFFAOYSA-N.
| Molecular formula | C26H35NO7 |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoate;oxalic acid |
| InChIKey | SSAJNPNVUYMUCI-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(CC1CCCO1)CC2=CC=CC3=CC=CC=C32.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)