Products 1215370-26-5
CAS 1215370-26-5 appears in our catalog under these names: Pioglitazone-d4 Ketone (M-III), Keto Pioglitazone-d4 (M-III), >95% (HPLC), Ketopioglitazone-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 0,5mg, 5mg, 500 μg, 5 mg, 1 mg.
5-[[4-[2-(5-acetyl-2-pyridinyl)ethoxy]-2,3,5,6-tetradeuteriophenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 1215370-26-5) is a chemical compound with the molecular formula C19H18N2O4S and a molecular weight of 374.4 g/mol. IUPAC name: 5-[[4-[2-(5-acetyl-2-pyridinyl)ethoxy]-2,3,5,6-tetradeuteriophenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: JMLKLMFMQRAJNI-USSMZTJJSA-N.
| Molecular formula | C19H18N2O4S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 5-[[4-[2-(5-acetyl-2-pyridinyl)ethoxy]-2,3,5,6-tetradeuteriophenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | JMLKLMFMQRAJNI-USSMZTJJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CC2C(=O)NC(=O)S2)[2H])[2H])OCCC3=NC=C(C=C3)C(=O)C)[2H] |
Computed by PubChem (NCBI)