CAS 1923052-14-5 is the registry number for Ethyl 2-benzyl-5-phenyl-2h-1,2,6-thiadiazine-4-carboxylate 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Ethyl 2-benzyl-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate (CAS 1923052-14-5) is a chemical compound with the molecular formula C19H18N2O4S and a molecular weight of 370.4 g/mol. IUPAC name: ethyl 2-benzyl-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate. InChIKey: YOJUMNVBCFFKPG-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O4S |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | ethyl 2-benzyl-1,1-dioxo-5-phenyl-1,2,6-thiadiazine-4-carboxylate |
| InChIKey | YOJUMNVBCFFKPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(S(=O)(=O)N=C1C2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)