Products 1215579-60-4

CAS 1215579-60-4 is the registry number for Tolmetin-d3 Ethyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate (CAS 1215579-60-4) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 288.36 g/mol. IUPAC name: ethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate. InChIKey: ZWFRUUBPYBQDCX-HPRDVNIFSA-N.

Identity
Molecular formulaC17H19NO3
Molecular weight288.36 g/mol
IUPAC nameethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate
InChIKeyZWFRUUBPYBQDCX-HPRDVNIFSA-N
SMILES[2H]C([2H])([2H])N1C(=CC=C1C(=O)C2=CC=C(C=C2)C)CC(=O)OCC

Computed by PubChem (NCBI)