CAS 1215579-60-4 is the registry number for Tolmetin-d3 Ethyl Ester. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Ethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate (CAS 1215579-60-4) is a chemical compound with the molecular formula C17H19NO3 and a molecular weight of 288.36 g/mol. IUPAC name: ethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate. InChIKey: ZWFRUUBPYBQDCX-HPRDVNIFSA-N.
| Molecular formula | C17H19NO3 |
|---|---|
| Molecular weight | 288.36 g/mol |
| IUPAC name | ethyl 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetate |
| InChIKey | ZWFRUUBPYBQDCX-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CC=C1C(=O)C2=CC=C(C=C2)C)CC(=O)OCC |
Computed by PubChem (NCBI)