CAS 1215691-18-1 is the registry number for N-Nitroso-N-methyl-3-aminopropionic Acid-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.
3-[nitroso(trideuteriomethyl)amino]propanoic acid (CAS 1215691-18-1) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 135.14 g/mol. IUPAC name: 3-[nitroso(trideuteriomethyl)amino]propanoic acid. InChIKey: JZVIGHIXBBLOEB-FIBGUPNXSA-N.
| Molecular formula | C4H8N2O3 |
|---|---|
| Molecular weight | 135.14 g/mol |
| IUPAC name | 3-[nitroso(trideuteriomethyl)amino]propanoic acid |
| InChIKey | JZVIGHIXBBLOEB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC(=O)O)N=O |
Computed by PubChem (NCBI)