Products 1215691-18-1

CAS 1215691-18-1 is the registry number for N-Nitroso-N-methyl-3-aminopropionic Acid-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

3-[nitroso(trideuteriomethyl)amino]propanoic acid (CAS 1215691-18-1) is a chemical compound with the molecular formula C4H8N2O3 and a molecular weight of 135.14 g/mol. IUPAC name: 3-[nitroso(trideuteriomethyl)amino]propanoic acid. InChIKey: JZVIGHIXBBLOEB-FIBGUPNXSA-N.

Identity
Molecular formulaC4H8N2O3
Molecular weight135.14 g/mol
IUPAC name3-[nitroso(trideuteriomethyl)amino]propanoic acid
InChIKeyJZVIGHIXBBLOEB-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])N(CCC(=O)O)N=O

Computed by PubChem (NCBI)