CAS 1215797-41-3 appears in our catalog under these names: Didesethyl Chloroquine-d4, Didesethyl Chloroquine-d4, >95% (HPLC), Didesethyl chloroquine–d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
4-N-(7-chloroquinolin-4-yl)-1,1,2,2-tetradeuteriopentane-1,4-diamine (CAS 1215797-41-3) is a chemical compound with the molecular formula C14H18ClN3 and a molecular weight of 267.79 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)-1,1,2,2-tetradeuteriopentane-1,4-diamine. InChIKey: GYEDIFVVTRKXHP-BRVWLQDISA-N.
| Molecular formula | C14H18ClN3 |
|---|---|
| Molecular weight | 267.79 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)-1,1,2,2-tetradeuteriopentane-1,4-diamine |
| InChIKey | GYEDIFVVTRKXHP-BRVWLQDISA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])N |
Computed by PubChem (NCBI)