Products 4298-14-0
CAS 4298-14-0 appears in our catalog under these names: Didesethyl Chloroquine, Didesethyl Chloroquine, >95% (HPLC), Didesethyl chloroquine, 98%, Didesethyl chloroquine/ 100%, Didesethyl chloroquine. Offered by: Chemat Brand, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 1 mg.
4-N-(7-chloroquinolin-4-yl)pentane-1,4-diamine (CAS 4298-14-0) is a chemical compound with the molecular formula C14H18ClN3 and a molecular weight of 263.76 g/mol. IUPAC name: 4-N-(7-chloroquinolin-4-yl)pentane-1,4-diamine. InChIKey: GYEDIFVVTRKXHP-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3 |
|---|---|
| Molecular weight | 263.76 g/mol |
| IUPAC name | 4-N-(7-chloroquinolin-4-yl)pentane-1,4-diamine |
| InChIKey | GYEDIFVVTRKXHP-UHFFFAOYSA-N |
| SMILES | CC(CCCN)NC1=C2C=CC(=CC2=NC=C1)Cl |
Computed by PubChem (NCBI)