Products 1215800-33-1
CAS 1215800-33-1 is the registry number for Dimethyl (2-Oxononyl)phosphonate-d15. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 25 mg, 100 mg, 50 mg, 10 mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecadeuterio-1-dimethoxyphosphorylnonan-2-one (CAS 1215800-33-1) is a chemical compound with the molecular formula C11H23O4P and a molecular weight of 265.36 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecadeuterio-1-dimethoxyphosphorylnonan-2-one. InChIKey: CVMKPYXSQWWZFH-OMISAEHXSA-N.
| Molecular formula | C11H23O4P |
|---|---|
| Molecular weight | 265.36 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecadeuterio-1-dimethoxyphosphorylnonan-2-one |
| InChIKey | CVMKPYXSQWWZFH-OMISAEHXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)CP(=O)(OC)OC |
Computed by PubChem (NCBI)