CAS 1329642-51-4 appears in our catalog under these names: Dimethyl (4S)-4-Methyl-(2-oxooctyl)phosphonate-d3, Dimethyl (S)-(4-(methyl-d3)-2-oxooctyl)phosphonate. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 25 mg, 100 mg, 50 mg.
(4S)-1-dimethoxyphosphoryl-4-(trideuteriomethyl)octan-2-one (CAS 1329642-51-4) is a chemical compound with the molecular formula C11H23O4P and a molecular weight of 253.29 g/mol. IUPAC name: (4S)-1-dimethoxyphosphoryl-4-(trideuteriomethyl)octan-2-one. InChIKey: OGGRBKUQRPKXIC-XBKOTWQMSA-N.
| Molecular formula | C11H23O4P |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (4S)-1-dimethoxyphosphoryl-4-(trideuteriomethyl)octan-2-one |
| InChIKey | OGGRBKUQRPKXIC-XBKOTWQMSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](CCCC)CC(=O)CP(=O)(OC)OC |
Computed by PubChem (NCBI)