CAS 1215898-55-7 appears in our catalog under these names: Mirtazapine-d4, >95% (HPLC), Mirtazapine–d4, Mirtazapine-d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
3,3,4,4-tetradeuterio-5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene (CAS 1215898-55-7) is a chemical compound with the molecular formula C17H19N3 and a molecular weight of 269.38 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene. InChIKey: RONZAEMNMFQXRA-YQUBHJMPSA-N.
| Molecular formula | C17H19N3 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-5-methyl-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| InChIKey | RONZAEMNMFQXRA-YQUBHJMPSA-N |
| SMILES | [2H]C1(C(N2C(CN1C)C3=CC=CC=C3CC4=C2N=CC=C4)([2H])[2H])[2H] |
Computed by PubChem (NCBI)