Products 1216678-68-0
CAS 1216678-68-0 appears in our catalog under these names: Mirtazapine-d3, >95% (HPLC), Mirtazapine D3, Mirtazapine D3, Mirtazapine-d3, 99.68%. Offered by: TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10mM/1mL, 10 mg, 5 mg, 1 mg.
5-(trideuteriomethyl)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene (CAS 1216678-68-0) is a chemical compound with the molecular formula C17H19N3 and a molecular weight of 268.37 g/mol. IUPAC name: 5-(trideuteriomethyl)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene. InChIKey: RONZAEMNMFQXRA-FIBGUPNXSA-N.
| Molecular formula | C17H19N3 |
|---|---|
| Molecular weight | 268.37 g/mol |
| IUPAC name | 5-(trideuteriomethyl)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaene |
| InChIKey | RONZAEMNMFQXRA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4 |
Computed by PubChem (NCBI)