Products 1215933-97-3
CAS 1215933-97-3 is the registry number for 5-Bromo-2-(piperazin-1-yl)pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-piperazin-1-ylpyridin-3-amine (CAS 1215933-97-3) is a chemical compound with the molecular formula C9H13BrN4 and a molecular weight of 257.13 g/mol. IUPAC name: 5-bromo-2-piperazin-1-ylpyridin-3-amine. InChIKey: MAFRXAXXRSMUTK-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN4 |
|---|---|
| Molecular weight | 257.13 g/mol |
| IUPAC name | 5-bromo-2-piperazin-1-ylpyridin-3-amine |
| InChIKey | MAFRXAXXRSMUTK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)