Products 1216009-33-4
CAS 1216009-33-4 appears in our catalog under these names: 4-Ethoxy-2,3-dimethylbenzoic acid, 4-Ethoxy-2,3-dimethylbenzoic acid, 95%, 4-Ethoxy-2,3-dimethylbenzoic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 250mg.
4-ethoxy-2,3-dimethylbenzoic acid (CAS 1216009-33-4) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-ethoxy-2,3-dimethylbenzoic acid. InChIKey: ZMXIXQCNUQSDMX-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-ethoxy-2,3-dimethylbenzoic acid |
| InChIKey | ZMXIXQCNUQSDMX-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C=C1)C(=O)O)C)C |
Computed by PubChem (NCBI)