CAS 1216262-47-3 is the registry number for 2,2-Difluoro-(2h)-1,4-benzothiazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,2-difluoro-4H-1,4-benzothiazin-3-one (CAS 1216262-47-3) is a chemical compound with the molecular formula C8H5F2NOS and a molecular weight of 201.20 g/mol. IUPAC name: 2,2-difluoro-4H-1,4-benzothiazin-3-one. InChIKey: SPGQWAYVHKUUAZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NOS |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 2,2-difluoro-4H-1,4-benzothiazin-3-one |
| InChIKey | SPGQWAYVHKUUAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(S2)(F)F |
Computed by PubChem (NCBI)