Products 865149-70-8
CAS 865149-70-8 is the registry number for 3-(Difluoromethoxy)phenylisothiocyanate, 95.0%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(difluoromethoxy)-3-isothiocyanatobenzene (CAS 865149-70-8) is a chemical compound with the molecular formula C8H5F2NOS and a molecular weight of 201.20 g/mol. IUPAC name: 1-(difluoromethoxy)-3-isothiocyanatobenzene. InChIKey: WVUHUSMEEQIPKP-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NOS |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 1-(difluoromethoxy)-3-isothiocyanatobenzene |
| InChIKey | WVUHUSMEEQIPKP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)F)N=C=S |
Computed by PubChem (NCBI)