CAS 1216276-56-0 is the registry number for (3-(4-Phenylthiazol-2-yl)phenyl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride (CAS 1216276-56-0) is a chemical compound with the molecular formula C16H15ClN2S and a molecular weight of 302.8 g/mol. IUPAC name: [3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride. InChIKey: UZTCTNPTRYBBHS-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2S |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | [3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methanamine;hydrochloride |
| InChIKey | UZTCTNPTRYBBHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)C3=CC=CC(=C3)CN.Cl |
Computed by PubChem (NCBI)