CAS 879896-44-3 is the registry number for (2,4-Diphenyl-1,3-thiazol-5-yl)methylamine hydrochloride, 95% . Offered by: Thermo Scientific. Available pack sizes: 1g.
(2,4-diphenyl-1,3-thiazol-5-yl)methanamine;hydrochloride (CAS 879896-44-3) is a chemical compound with the molecular formula C16H15ClN2S and a molecular weight of 302.8 g/mol. IUPAC name: (2,4-diphenyl-1,3-thiazol-5-yl)methanamine;hydrochloride. InChIKey: REDARXMRPRJWQP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2S |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | (2,4-diphenyl-1,3-thiazol-5-yl)methanamine;hydrochloride |
| InChIKey | REDARXMRPRJWQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=CC=CC=C3)CN.Cl |
Computed by PubChem (NCBI)