CAS 1216318-80-7 is the registry number for 6-(2,5-Dimethylmorpholino)nicotinimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,5-dimethylmorpholin-4-yl)pyridine-3-carboximidamide (CAS 1216318-80-7) is a chemical compound with the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. IUPAC name: 6-(2,5-dimethylmorpholin-4-yl)pyridine-3-carboximidamide. InChIKey: NCNAAYVRRQGQAT-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O |
|---|---|
| Molecular weight | 234.30 g/mol |
| IUPAC name | 6-(2,5-dimethylmorpholin-4-yl)pyridine-3-carboximidamide |
| InChIKey | NCNAAYVRRQGQAT-UHFFFAOYSA-N |
| SMILES | CC1CN(C(CO1)C)C2=NC=C(C=C2)C(=N)N |
Computed by PubChem (NCBI)