Products 1379098-82-4
CAS 1379098-82-4 is the registry number for 5-((4,6-Dimethylpyrimidin-2-yl)amino)-1-methylpiperidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpiperidin-2-one (CAS 1379098-82-4) is a chemical compound with the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. IUPAC name: 5-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpiperidin-2-one. InChIKey: NTCSAVFWBCPILY-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O |
|---|---|
| Molecular weight | 234.30 g/mol |
| IUPAC name | 5-[(4,6-dimethylpyrimidin-2-yl)amino]-1-methylpiperidin-2-one |
| InChIKey | NTCSAVFWBCPILY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2CCC(=O)N(C2)C)C |
Computed by PubChem (NCBI)